C35H30N4O5S — CID 6693620
2-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6693620) has the molecular formula C35H30N4O5S and a molecular weight of 618.72 g/mol. Its IUPAC name is 2-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6693620 |
| Molecular Formula | C35H30N4O5S |
| Molecular Weight | 618.72 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | 2-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cccc(-c2ccc([C@@H]3O[C@H](CSc4ncn[nH]4)C[C@H](c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C35H30N4O5S/c40-19-22-8-10-25(11-9-22)31-17-28(20-45-35-36-21-37-38-35)43-34(44-31)26-14-12-24(13-15-26)27-5-3-4-23(16-27)18-39-32(41)29-6-1-2-7-30(29)33(39)42/h1-16,21,28,31,34,40H,17-20H2,(H,36,37,38)/t28-,31+,34+/m0/s1 |
| InChIKey | BIYCXNYLXWBPKE-LKQHQURMSA-N |
| XLogP | 6.10 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.72 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|