C31H35NO6S — CID 5175949
prop-2-enyl N-[[3-[3-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate (PubChem CID 5175949) has the molecular formula C31H35NO6S and a molecular weight of 549.69 g/mol. Its IUPAC name is prop-2-enyl N-[[3-[3-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate.
| Compound Name | prop-2-enyl N-[[3-[3-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 5175949 |
| Molecular Formula | C31H35NO6S |
| Molecular Weight | 549.69 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | prop-2-enyl N-[[3-[3-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate |
| SMILES | C=CCOC(=O)NCc1cccc(-c2cccc(C3OC(CSCCO)CC(c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C31H35NO6S/c1-2-14-36-31(35)32-19-23-5-3-6-25(16-23)26-7-4-8-27(17-26)30-37-28(21-39-15-13-33)18-29(38-30)24-11-9-22(20-34)10-12-24/h2-12,16-17,28-30,33-34H,1,13-15,18-21H2,(H,32,35) |
| InChIKey | WHJJTOAAQZUCHH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.69 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|