C24H29NO6S — CID 6706227
prop-2-enyl N-[4-[(2S,4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamate (PubChem CID 6706227) has the molecular formula C24H29NO6S and a molecular weight of 459.56 g/mol. Its IUPAC name is prop-2-enyl N-[4-[(2S,4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamate.
| Compound Name | prop-2-enyl N-[4-[(2S,4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 6706227 |
| Molecular Formula | C24H29NO6S |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | prop-2-enyl N-[4-[(2S,4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamate |
| SMILES | C=CCOC(=O)Nc1ccc([C@@H]2O[C@H](CSCCO)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C24H29NO6S/c1-2-12-29-24(28)25-20-9-7-19(8-10-20)23-30-21(16-32-13-11-26)14-22(31-23)18-5-3-17(15-27)4-6-18/h2-10,21-23,26-27H,1,11-16H2,(H,25,28)/t21-,22+,23+/m0/s1 |
| InChIKey | GVECZUZXZAAASP-YTFSRNRJSA-N |
| XLogP | 4.18 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|