C27H35NO7S — CID 3587995
7-[4-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid (PubChem CID 3587995) has the molecular formula C27H35NO7S and a molecular weight of 517.64 g/mol. Its IUPAC name is 7-[4-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid.
| Compound Name | 7-[4-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 3587995 |
| Molecular Formula | C27H35NO7S |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 7-[4-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid |
| SMILES | O=C(O)CCCCCC(=O)Nc1ccc(C2OC(CSCCO)CC(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C27H35NO7S/c29-14-15-36-18-23-16-24(20-8-6-19(17-30)7-9-20)35-27(34-23)21-10-12-22(13-11-21)28-25(31)4-2-1-3-5-26(32)33/h6-13,23-24,27,29-30H,1-5,14-18H2,(H,28,31)(H,32,33) |
| InChIKey | IZBVYBCXPABGOS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|