C27H36N2O7S — CID 6675945
N'-hydroxy-N-[4-[(2S,4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]heptanediamide (PubChem CID 6675945) has the molecular formula C27H36N2O7S and a molecular weight of 532.66 g/mol. Its IUPAC name is N'-hydroxy-N-[4-[(2S,4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]heptanediamide.
| Compound Name | N'-hydroxy-N-[4-[(2S,4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
|---|---|
| PubChem CID | 6675945 |
| Molecular Formula | C27H36N2O7S |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | N'-hydroxy-N-[4-[(2S,4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
| SMILES | O=C(CCCCCC(=O)Nc1ccc([C@@H]2O[C@H](CSCCO)C[C@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C27H36N2O7S/c30-14-15-37-18-23-16-24(20-8-6-19(17-31)7-9-20)36-27(35-23)21-10-12-22(13-11-21)28-25(32)4-2-1-3-5-26(33)29-34/h6-13,23-24,27,30-31,34H,1-5,14-18H2,(H,28,32)(H,29,33)/t23-,24+,27+/m0/s1 |
| InChIKey | AOSOVBRPJIXBTB-CLCZQPDDSA-N |
| XLogP | 3.84 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|