C26H34N2O6S — CID 125032751
N'-hydroxy-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(sulfanylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide (PubChem CID 125032751) has the molecular formula C26H34N2O6S and a molecular weight of 502.63 g/mol. Its IUPAC name is N'-hydroxy-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(sulfanylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide.
| Compound Name | N'-hydroxy-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(sulfanylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 125032751 |
| Molecular Formula | C26H34N2O6S |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | N'-hydroxy-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(sulfanylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1ccc([C@H]2O[C@@H](CS)C[C@@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C26H34N2O6S/c29-16-18-7-9-19(10-8-18)23-15-22(17-35)33-26(34-23)20-11-13-21(14-12-20)27-24(30)5-3-1-2-4-6-25(31)28-32/h7-14,22-23,26,29,32,35H,1-6,15-17H2,(H,27,30)(H,28,31)/t22-,23+,26+/m1/s1 |
| InChIKey | HNHPCOMCQVDBBZ-UMFSSWHCSA-N |
| XLogP | 4.44 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|