C30H41N3O7 — CID 5127043
N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide (PubChem CID 5127043) has the molecular formula C30H41N3O7 and a molecular weight of 555.67 g/mol. Its IUPAC name is N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide.
| Compound Name | N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 5127043 |
| Molecular Formula | C30H41N3O7 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.29 |
| IUPAC Name | N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1ccc(C2OC(CN3CCOCC3)CC(c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C30H41N3O7/c34-21-22-7-9-23(10-8-22)27-19-26(20-33-15-17-38-18-16-33)39-30(40-27)24-11-13-25(14-12-24)31-28(35)5-3-1-2-4-6-29(36)32-37/h7-14,26-27,30,34,37H,1-6,15-21H2,(H,31,35)(H,32,36) |
| InChIKey | GXNOCKUNISMLTN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|