C30H39N3O8 — CID 6677595
N-[4-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxypentanediamide (PubChem CID 6677595) has the molecular formula C30H39N3O8 and a molecular weight of 569.66 g/mol. Its IUPAC name is N-[4-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxypentanediamide.
| Compound Name | N-[4-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxypentanediamide |
|---|---|
| PubChem CID | 6677595 |
| Molecular Formula | C30H39N3O8 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | N-[4-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxypentanediamide |
| SMILES | O=C(CCCC(=O)Nc1ccc([C@@H]2O[C@H](CN3CCC4(CC3)OCCO4)C[C@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C30H39N3O8/c34-20-21-4-6-22(7-5-21)26-18-25(19-33-14-12-30(13-15-33)38-16-17-39-30)40-29(41-26)23-8-10-24(11-9-23)31-27(35)2-1-3-28(36)32-37/h4-11,25-26,29,34,37H,1-3,12-20H2,(H,31,35)(H,32,36)/t25-,26+,29+/m0/s1 |
| InChIKey | ZKOCVZGAFTXFPL-IWVFXYMLSA-N |
| XLogP | 3.18 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|