C31H41N3O8 — CID 6673998
N-[4-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyhexanediamide (PubChem CID 6673998) has the molecular formula C31H41N3O8 and a molecular weight of 583.68 g/mol. Its IUPAC name is N-[4-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyhexanediamide.
| Compound Name | N-[4-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyhexanediamide |
|---|---|
| PubChem CID | 6673998 |
| Molecular Formula | C31H41N3O8 |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | N-[4-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyhexanediamide |
| SMILES | O=C(CCCCC(=O)Nc1ccc([C@H]2O[C@@H](CN3CCC4(CC3)OCCO4)C[C@@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C31H41N3O8/c35-21-22-5-7-23(8-6-22)27-19-26(20-34-15-13-31(14-16-34)39-17-18-40-31)41-30(42-27)24-9-11-25(12-10-24)32-28(36)3-1-2-4-29(37)33-38/h5-12,26-27,30,35,38H,1-4,13-21H2,(H,32,36)(H,33,37)/t26-,27+,30+/m1/s1 |
| InChIKey | LUKYHGBGWUWLFR-WWDWLDGVSA-N |
| XLogP | 3.57 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|