C39H50N4O7 — CID 6677605
N'-(2-aminophenyl)-N-[4-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]octanediamide (PubChem CID 6677605) has the molecular formula C39H50N4O7 and a molecular weight of 686.85 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[4-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[4-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 6677605 |
| Molecular Formula | C39H50N4O7 |
| Molecular Weight | 686.85 g/mol |
| Exact Mass | 686.37 |
| IUPAC Name | N'-(2-aminophenyl)-N-[4-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)Nc1ccc([C@@H]2O[C@H](CN3CCC4(CC3)OCCO4)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C39H50N4O7/c40-33-7-5-6-8-34(33)42-37(46)10-4-2-1-3-9-36(45)41-31-17-15-30(16-18-31)38-49-32(25-35(50-38)29-13-11-28(27-44)12-14-29)26-43-21-19-39(20-22-43)47-23-24-48-39/h5-8,11-18,32,35,38,44H,1-4,9-10,19-27,40H2,(H,41,45)(H,42,46)/t32-,35+,38+/m0/s1 |
| InChIKey | ZGWPKRCEDHDCDF-IQNKFNROSA-N |
| XLogP | 6.06 |
| TPSA | 144.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.85 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|