C39H52N4O5 — CID 6673006
N'-(2-aminophenyl)-N-[[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide (PubChem CID 6673006) has the molecular formula C39H52N4O5 and a molecular weight of 656.87 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 6673006 |
| Molecular Formula | C39H52N4O5 |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 656.39 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCC(=O)NCc1ccc([C@H]2O[C@@H](CN3CCCCCCC3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C39H52N4O5/c40-34-11-7-8-12-35(34)42-38(46)14-6-4-5-13-37(45)41-26-29-15-21-32(22-16-29)39-47-33(27-43-23-9-2-1-3-10-24-43)25-36(48-39)31-19-17-30(28-44)18-20-31/h7-8,11-12,15-22,33,36,39,44H,1-6,9-10,13-14,23-28,40H2,(H,41,45)(H,42,46)/t33-,36+,39+/m1/s1 |
| InChIKey | RJWBVEVKRKLYDE-OVDDFZKSSA-N |
| XLogP | 6.78 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|