C41H51N7O5 — CID 4029157
N'-(2-aminophenyl)-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide (PubChem CID 4029157) has the molecular formula C41H51N7O5 and a molecular weight of 721.90 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 4029157 |
| Molecular Formula | C41H51N7O5 |
| Molecular Weight | 721.90 g/mol |
| Exact Mass | 721.40 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)NCc1ccc(C2OC(CN3CCN(c4ncccn4)CC3)CC(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C41H51N7O5/c42-35-8-5-6-9-36(35)46-39(51)11-4-2-1-3-10-38(50)45-27-30-12-18-33(19-13-30)40-52-34(26-37(53-40)32-16-14-31(29-49)15-17-32)28-47-22-24-48(25-23-47)41-43-20-7-21-44-41/h5-9,12-21,34,37,40,49H,1-4,10-11,22-29,42H2,(H,45,50)(H,46,51) |
| InChIKey | OBAWIMOULOVAIZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 155.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.90 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|