C43H52N4O6 — CID 6672529
N'-(2-aminophenyl)-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide (PubChem CID 6672529) has the molecular formula C43H52N4O6 and a molecular weight of 720.91 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 6672529 |
| Molecular Formula | C43H52N4O6 |
| Molecular Weight | 720.91 g/mol |
| Exact Mass | 720.39 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)NCc1ccccc1-c1ccc([C@H]2O[C@@H](CN3CCOCC3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C43H52N4O6/c44-38-11-7-8-12-39(38)46-42(50)14-4-2-1-3-13-41(49)45-28-35-9-5-6-10-37(35)32-19-21-34(22-20-32)43-52-36(29-47-23-25-51-26-24-47)27-40(53-43)33-17-15-31(30-48)16-18-33/h5-12,15-22,36,40,43,48H,1-4,13-14,23-30,44H2,(H,45,49)(H,46,50)/t36-,40+,43+/m1/s1 |
| InChIKey | UTPBYCSFWYGFOG-ZXYGFAFNSA-N |
| XLogP | 6.90 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.91 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|