C45H47N5O5 — CID 3620942
N'-(2-aminophenyl)-N-[[2-[4-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide (PubChem CID 3620942) has the molecular formula C45H47N5O5 and a molecular weight of 737.90 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[2-[4-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[2-[4-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 3620942 |
| Molecular Formula | C45H47N5O5 |
| Molecular Weight | 737.90 g/mol |
| Exact Mass | 737.36 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[2-[4-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCC(=O)NCc1ccccc1-c1ccc(C2OC(Cn3cnc4ccccc43)CC(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C45H47N5O5/c46-38-12-6-7-13-39(38)49-44(53)17-3-1-2-16-43(52)47-27-35-10-4-5-11-37(35)32-22-24-34(25-23-32)45-54-36(28-50-30-48-40-14-8-9-15-41(40)50)26-42(55-45)33-20-18-31(29-51)19-21-33/h4-15,18-25,30,36,42,45,51H,1-3,16-17,26-29,46H2,(H,47,52)(H,49,53) |
| InChIKey | TYCZDAQXXBEPRB-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.90 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|