C33H38N4O6 — CID 6676965
N-[[4-[(2S,4S,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-N'-hydroxyheptanediamide (PubChem CID 6676965) has the molecular formula C33H38N4O6 and a molecular weight of 586.69 g/mol. Its IUPAC name is N-[[4-[(2S,4S,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-N'-hydroxyheptanediamide.
| Compound Name | N-[[4-[(2S,4S,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-N'-hydroxyheptanediamide |
|---|---|
| PubChem CID | 6676965 |
| Molecular Formula | C33H38N4O6 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | N-[[4-[(2S,4S,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-N'-hydroxyheptanediamide |
| SMILES | O=C(CCCCCC(=O)NCc1ccc([C@@H]2O[C@H](Cn3cnc4ccccc43)C[C@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C33H38N4O6/c38-21-24-12-14-25(15-13-24)30-18-27(20-37-22-35-28-6-4-5-7-29(28)37)42-33(43-30)26-16-10-23(11-17-26)19-34-31(39)8-2-1-3-9-32(40)36-41/h4-7,10-17,22,27,30,33,38,41H,1-3,8-9,18-21H2,(H,34,39)(H,36,40)/t27-,30+,33+/m0/s1 |
| InChIKey | JDPSXLXRYLWPKG-LTXBTDFWSA-N |
| XLogP | 4.85 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|