C37H38N4O6 — CID 3556158
N-[[3-[3-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxypentanediamide (PubChem CID 3556158) has the molecular formula C37H38N4O6 and a molecular weight of 634.73 g/mol. Its IUPAC name is N-[[3-[3-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxypentanediamide.
| Compound Name | N-[[3-[3-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxypentanediamide |
|---|---|
| PubChem CID | 3556158 |
| Molecular Formula | C37H38N4O6 |
| Molecular Weight | 634.73 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | N-[[3-[3-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxypentanediamide |
| SMILES | O=C(CCCC(=O)NCc1cccc(-c2cccc(C3OC(Cn4cnc5ccccc54)CC(c4ccc(CO)cc4)O3)c2)c1)NO |
| InChI | InChI=1S/C37H38N4O6/c42-23-25-14-16-27(17-15-25)34-20-31(22-41-24-39-32-10-1-2-11-33(32)41)46-37(47-34)30-9-4-8-29(19-30)28-7-3-6-26(18-28)21-38-35(43)12-5-13-36(44)40-45/h1-4,6-11,14-19,24,31,34,37,42,45H,5,12-13,20-23H2,(H,38,43)(H,40,44) |
| InChIKey | MWTCJVUIIKVVKE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.73 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|