C44H45N5O5 — CID 6676975
N'-(2-aminophenyl)-N-[[3-[4-[(2S,4S,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide (PubChem CID 6676975) has the molecular formula C44H45N5O5 and a molecular weight of 723.87 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[4-[(2S,4S,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[4-[(2S,4S,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 6676975 |
| Molecular Formula | C44H45N5O5 |
| Molecular Weight | 723.87 g/mol |
| Exact Mass | 723.34 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[4-[(2S,4S,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCC(=O)NCc1cccc(-c2ccc([C@@H]3O[C@H](Cn4cnc5ccccc54)C[C@H](c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C44H45N5O5/c45-37-10-1-2-11-38(37)48-43(52)15-6-5-14-42(51)46-26-31-8-7-9-35(24-31)32-20-22-34(23-21-32)44-53-36(27-49-29-47-39-12-3-4-13-40(39)49)25-41(54-44)33-18-16-30(28-50)17-19-33/h1-4,7-13,16-24,29,36,41,44,50H,5-6,14-15,25-28,45H2,(H,46,51)(H,48,52)/t36-,41+,44+/m0/s1 |
| InChIKey | BJJYCZJIIWEHEI-MFUISKDRSA-N |
| XLogP | 7.84 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.87 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|