C39H43N5O5 — CID 6673345
N'-(2-aminophenyl)-N-[3-[(2R,4R,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]octanediamide (PubChem CID 6673345) has the molecular formula C39H43N5O5 and a molecular weight of 661.80 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[(2R,4R,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[(2R,4R,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 6673345 |
| Molecular Formula | C39H43N5O5 |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.33 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[(2R,4R,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)Nc1cccc([C@H]2O[C@@H](Cn3cnc4ccccc43)C[C@@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C39H43N5O5/c40-32-12-5-6-13-33(32)43-38(47)17-4-2-1-3-16-37(46)42-30-11-9-10-29(22-30)39-48-31(24-44-26-41-34-14-7-8-15-35(34)44)23-36(49-39)28-20-18-27(25-45)19-21-28/h5-15,18-22,26,31,36,39,45H,1-4,16-17,23-25,40H2,(H,42,46)(H,43,47)/t31-,36+,39+/m1/s1 |
| InChIKey | XHZRNWFSAAPIKD-SFIVIJABSA-N |
| XLogP | 7.27 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|