C33H35Cl2N5O5 — CID 6677371
N'-(2-aminophenyl)-N-[3-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 6677371) has the molecular formula C33H35Cl2N5O5 and a molecular weight of 652.58 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 6677371 |
| Molecular Formula | C33H35Cl2N5O5 |
| Molecular Weight | 652.58 g/mol |
| Exact Mass | 651.20 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCC(=O)Nc1cccc([C@@H]2O[C@H](Cn3cnc(Cl)c3Cl)C[C@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C33H35Cl2N5O5/c34-31-32(35)40(20-37-31)18-25-17-28(22-14-12-21(19-41)13-15-22)45-33(44-25)23-6-5-7-24(16-23)38-29(42)10-3-4-11-30(43)39-27-9-2-1-8-26(27)36/h1-2,5-9,12-16,20,25,28,33,41H,3-4,10-11,17-19,36H2,(H,38,42)(H,39,43)/t25-,28+,33+/m0/s1 |
| InChIKey | RKCVVNKDRBSIIN-YECBMXPCSA-N |
| XLogP | 6.65 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.58 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|