C28H32Cl2N4O6 — CID 6673785
N-[4-[(2R,4R,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyheptanediamide (PubChem CID 6673785) has the molecular formula C28H32Cl2N4O6 and a molecular weight of 591.49 g/mol. Its IUPAC name is N-[4-[(2R,4R,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyheptanediamide.
| Compound Name | N-[4-[(2R,4R,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyheptanediamide |
|---|---|
| PubChem CID | 6673785 |
| Molecular Formula | C28H32Cl2N4O6 |
| Molecular Weight | 591.49 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | N-[4-[(2R,4R,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyheptanediamide |
| SMILES | O=C(CCCCCC(=O)Nc1ccc([C@H]2O[C@@H](Cn3cnc(Cl)c3Cl)C[C@@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C28H32Cl2N4O6/c29-26-27(30)34(17-31-26)15-22-14-23(19-8-6-18(16-35)7-9-19)40-28(39-22)20-10-12-21(13-11-20)32-24(36)4-2-1-3-5-25(37)33-38/h6-13,17,22-23,28,35,38H,1-5,14-16H2,(H,32,36)(H,33,37)/t22-,23+,28+/m1/s1 |
| InChIKey | MLGYAGJUXGSYEK-IWHLBADBSA-N |
| XLogP | 5.32 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|