C32H33Cl2N5O5 — CID 6677368
N'-(2-aminophenyl)-N-[3-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]pentanediamide (PubChem CID 6677368) has the molecular formula C32H33Cl2N5O5 and a molecular weight of 638.55 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]pentanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]pentanediamide |
|---|---|
| PubChem CID | 6677368 |
| Molecular Formula | C32H33Cl2N5O5 |
| Molecular Weight | 638.55 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]pentanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCC(=O)Nc1cccc([C@@H]2O[C@H](Cn3cnc(Cl)c3Cl)C[C@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C32H33Cl2N5O5/c33-30-31(34)39(19-36-30)17-24-16-27(21-13-11-20(18-40)12-14-21)44-32(43-24)22-5-3-6-23(15-22)37-28(41)9-4-10-29(42)38-26-8-2-1-7-25(26)35/h1-3,5-8,11-15,19,24,27,32,40H,4,9-10,16-18,35H2,(H,37,41)(H,38,42)/t24-,27+,32+/m0/s1 |
| InChIKey | SMJVAWZUWCHRGW-WIIJYMMWSA-N |
| XLogP | 6.26 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.55 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|