C41H43Cl2N5O5 — CID 6677422
N'-(2-aminophenyl)-N-[[2-[4-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide (PubChem CID 6677422) has the molecular formula C41H43Cl2N5O5 and a molecular weight of 756.73 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[2-[4-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[2-[4-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 6677422 |
| Molecular Formula | C41H43Cl2N5O5 |
| Molecular Weight | 756.73 g/mol |
| Exact Mass | 755.26 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[2-[4-[(2S,4S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCC(=O)NCc1ccccc1-c1ccc([C@@H]2O[C@H](Cn3cnc(Cl)c3Cl)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C41H43Cl2N5O5/c42-39-40(43)48(26-46-39)24-32-22-36(29-16-14-27(25-49)15-17-29)53-41(52-32)30-20-18-28(19-21-30)33-9-5-4-8-31(33)23-45-37(50)12-2-1-3-13-38(51)47-35-11-7-6-10-34(35)44/h4-11,14-21,26,32,36,41,49H,1-3,12-13,22-25,44H2,(H,45,50)(H,47,51)/t32-,36+,41+/m0/s1 |
| InChIKey | MTMIJWNQIFKLDE-ZBSZAUDSSA-N |
| XLogP | 8.38 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.73 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|