C46H49N5O5 — CID 3387840
N'-(2-aminophenyl)-N-[[3-[4-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide (PubChem CID 3387840) has the molecular formula C46H49N5O5 and a molecular weight of 751.93 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[4-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[4-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 3387840 |
| Molecular Formula | C46H49N5O5 |
| Molecular Weight | 751.93 g/mol |
| Exact Mass | 751.37 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[4-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)NCc1cccc(-c2ccc(C3OC(Cn4cnc5ccccc54)CC(c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C46H49N5O5/c47-39-12-5-6-13-40(39)50-45(54)17-4-2-1-3-16-44(53)48-28-33-10-9-11-37(26-33)34-22-24-36(25-23-34)46-55-38(29-51-31-49-41-14-7-8-15-42(41)51)27-43(56-46)35-20-18-32(30-52)19-21-35/h5-15,18-26,31,38,43,46,52H,1-4,16-17,27-30,47H2,(H,48,53)(H,50,54) |
| InChIKey | PGDWIERAEGAARM-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.93 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|