C39H30F5N3O4 — CID 3441531
N-[[2-[4-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 3441531) has the molecular formula C39H30F5N3O4 and a molecular weight of 699.68 g/mol. Its IUPAC name is N-[[2-[4-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[[2-[4-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 3441531 |
| Molecular Formula | C39H30F5N3O4 |
| Molecular Weight | 699.68 g/mol |
| Exact Mass | 699.22 |
| IUPAC Name | N-[[2-[4-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(NCc1ccccc1-c1ccc(C2OC(Cn3cnc4ccccc43)CC(c3ccc(CO)cc3)O2)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C39H30F5N3O4/c40-33-32(34(41)36(43)37(44)35(33)42)38(49)45-18-26-5-1-2-6-28(26)23-13-15-25(16-14-23)39-50-27(19-47-21-46-29-7-3-4-8-30(29)47)17-31(51-39)24-11-9-22(20-48)10-12-24/h1-16,21,27,31,39,48H,17-20H2,(H,45,49) |
| InChIKey | SHMVDLHDYHYCFO-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.68 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|