C36H30F5N3O4S — CID 3292674
2,3,4,5,6-pentafluoro-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 3292674) has the molecular formula C36H30F5N3O4S and a molecular weight of 695.71 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 3292674 |
| Molecular Formula | C36H30F5N3O4S |
| Molecular Weight | 695.71 g/mol |
| Exact Mass | 695.19 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | Cn1ccnc1SCC1CC(c2ccc(CO)cc2)OC(c2ccc(-c3ccccc3CNC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)O1 |
| InChI | InChI=1S/C36H30F5N3O4S/c1-44-15-14-42-36(44)49-19-25-16-27(22-8-6-20(18-45)7-9-22)48-35(47-25)23-12-10-21(11-13-23)26-5-3-2-4-24(26)17-43-34(46)28-29(37)31(39)33(41)32(40)30(28)38/h2-15,25,27,35,45H,16-19H2,1H3,(H,43,46) |
| InChIKey | CSIPCZOLKGVQMS-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.71 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|