C34H30F5NO5S — CID 6693195
2,3,4,5,6-pentafluoro-N-[[2-[4-[(2S,4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 6693195) has the molecular formula C34H30F5NO5S and a molecular weight of 659.67 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[2-[4-[(2S,4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[2-[4-[(2S,4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6693195 |
| Molecular Formula | C34H30F5NO5S |
| Molecular Weight | 659.67 g/mol |
| Exact Mass | 659.18 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[2-[4-[(2S,4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccccc1-c1ccc([C@@H]2O[C@H](CSCCO)C[C@H](c3ccc(CO)cc3)O2)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C34H30F5NO5S/c35-28-27(29(36)31(38)32(39)30(28)37)33(43)40-16-23-3-1-2-4-25(23)20-9-11-22(12-10-20)34-44-24(18-46-14-13-41)15-26(45-34)21-7-5-19(17-42)6-8-21/h1-12,24,26,34,41-42H,13-18H2,(H,40,43)/t24-,26+,34+/m0/s1 |
| InChIKey | CHEVQKIEESOPJZ-DMXFMILNSA-N |
| XLogP | 6.74 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.67 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|