C40H39F5N2O4 — CID 6700448
N-[[2-[4-[(2R,4R,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 6700448) has the molecular formula C40H39F5N2O4 and a molecular weight of 706.75 g/mol. Its IUPAC name is N-[[2-[4-[(2R,4R,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[[2-[4-[(2R,4R,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 6700448 |
| Molecular Formula | C40H39F5N2O4 |
| Molecular Weight | 706.75 g/mol |
| Exact Mass | 706.28 |
| IUPAC Name | N-[[2-[4-[(2R,4R,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | C=CCN(C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(-c3ccccc3CNC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)O1)C1CCCC1 |
| InChI | InChI=1S/C40H39F5N2O4/c1-2-19-47(29-8-4-5-9-29)22-30-20-32(26-13-11-24(23-48)12-14-26)51-40(50-30)27-17-15-25(16-18-27)31-10-6-3-7-28(31)21-46-39(49)33-34(41)36(43)38(45)37(44)35(33)42/h2-3,6-7,10-18,29-30,32,40,48H,1,4-5,8-9,19-23H2,(H,46,49)/t30-,32+,40+/m1/s1 |
| InChIKey | DIUIPWQUFICXIH-GHMHRPTOSA-N |
| XLogP | 8.45 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.75 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|