C33H33F5N2O4 — CID 4625801
N-[3-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 4625801) has the molecular formula C33H33F5N2O4 and a molecular weight of 616.63 g/mol. Its IUPAC name is N-[3-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[3-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 4625801 |
| Molecular Formula | C33H33F5N2O4 |
| Molecular Weight | 616.63 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | N-[3-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | C=CCN(CC1CC(c2ccc(CO)cc2)OC(c2cccc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)c2)O1)C1CCCC1 |
| InChI | InChI=1S/C33H33F5N2O4/c1-2-14-40(23-8-3-4-9-23)17-24-16-25(20-12-10-19(18-41)11-13-20)44-33(43-24)21-6-5-7-22(15-21)39-32(42)26-27(34)29(36)31(38)30(37)28(26)35/h2,5-7,10-13,15,23-25,33,41H,1,3-4,8-9,14,16-18H2,(H,39,42) |
| InChIKey | ISOIOBHZQOEWCM-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.63 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|