C34H36N2O5 — CID 4531988
2-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 4531988) has the molecular formula C34H36N2O5 and a molecular weight of 552.67 g/mol. Its IUPAC name is 2-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4531988 |
| Molecular Formula | C34H36N2O5 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 2-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | C=CCN(CC1CC(c2ccc(CO)cc2)OC(c2ccc(N3C(=O)c4ccccc4C3=O)cc2)O1)C1CCCC1 |
| InChI | InChI=1S/C34H36N2O5/c1-2-19-35(26-7-3-4-8-26)21-28-20-31(24-13-11-23(22-37)12-14-24)41-34(40-28)25-15-17-27(18-16-25)36-32(38)29-9-5-6-10-30(29)33(36)39/h2,5-6,9-18,26,28,31,34,37H,1,3-4,7-8,19-22H2 |
| InChIKey | HZQDHIYIWJVULM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|