C41H52N2O6 — CID 5215641
8-[[2-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid (PubChem CID 5215641) has the molecular formula C41H52N2O6 and a molecular weight of 668.87 g/mol. Its IUPAC name is 8-[[2-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid.
| Compound Name | 8-[[2-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 5215641 |
| Molecular Formula | C41H52N2O6 |
| Molecular Weight | 668.87 g/mol |
| Exact Mass | 668.38 |
| IUPAC Name | 8-[[2-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid |
| SMILES | C=CCN(CC1CC(c2ccc(CO)cc2)OC(c2ccc(-c3ccccc3CNC(=O)CCCCCCC(=O)O)cc2)O1)C1CCCC1 |
| InChI | InChI=1S/C41H52N2O6/c1-2-25-43(35-12-8-9-13-35)28-36-26-38(32-19-17-30(29-44)18-20-32)49-41(48-36)33-23-21-31(22-24-33)37-14-10-7-11-34(37)27-42-39(45)15-5-3-4-6-16-40(46)47/h2,7,10-11,14,17-24,35-36,38,41,44H,1,3-6,8-9,12-13,15-16,25-29H2,(H,42,45)(H,46,47) |
| InChIKey | YZQLTGJMVFVSDL-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.87 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|