C41H53N3O6 — CID 6677124
N-[[3-[4-[(2S,4S,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide (PubChem CID 6677124) has the molecular formula C41H53N3O6 and a molecular weight of 683.89 g/mol. Its IUPAC name is N-[[3-[4-[(2S,4S,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[[3-[4-[(2S,4S,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 6677124 |
| Molecular Formula | C41H53N3O6 |
| Molecular Weight | 683.89 g/mol |
| Exact Mass | 683.39 |
| IUPAC Name | N-[[3-[4-[(2S,4S,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyoctanediamide |
| SMILES | C=CCN(C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(-c3cccc(CNC(=O)CCCCCCC(=O)NO)c3)cc2)O1)C1CCCC1 |
| InChI | InChI=1S/C41H53N3O6/c1-2-24-44(36-12-7-8-13-36)28-37-26-38(33-18-16-30(29-45)17-19-33)50-41(49-37)34-22-20-32(21-23-34)35-11-9-10-31(25-35)27-42-39(46)14-5-3-4-6-15-40(47)43-48/h2,9-11,16-23,25,36-38,41,45,48H,1,3-8,12-15,24,26-29H2,(H,42,46)(H,43,47)/t37-,38+,41+/m0/s1 |
| InChIKey | KBRRHYCXUVLGAM-XELUODRTSA-N |
| XLogP | 7.28 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.89 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|