C35H43N3O6 — CID 5163182
N'-hydroxy-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide (PubChem CID 5163182) has the molecular formula C35H43N3O6 and a molecular weight of 601.74 g/mol. Its IUPAC name is N'-hydroxy-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide.
| Compound Name | N'-hydroxy-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 5163182 |
| Molecular Formula | C35H43N3O6 |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | N'-hydroxy-N-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
| SMILES | C=CCN(C)CC1CC(c2ccc(CO)cc2)OC(c2cccc(-c3cccc(CNC(=O)CCCCC(=O)NO)c3)c2)O1 |
| InChI | InChI=1S/C35H43N3O6/c1-3-18-38(2)23-31-21-32(27-16-14-25(24-39)15-17-27)44-35(43-31)30-11-7-10-29(20-30)28-9-6-8-26(19-28)22-36-33(40)12-4-5-13-34(41)37-42/h3,6-11,14-17,19-20,31-32,35,39,42H,1,4-5,12-13,18,21-24H2,2H3,(H,36,40)(H,37,41) |
| InChIKey | YFTRCOMRDZKHDL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|