C44H52N4O5 — CID 3882272
N'-(2-aminophenyl)-N-[[3-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide (PubChem CID 3882272) has the molecular formula C44H52N4O5 and a molecular weight of 716.92 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
|---|---|
| PubChem CID | 3882272 |
| Molecular Formula | C44H52N4O5 |
| Molecular Weight | 716.92 g/mol |
| Exact Mass | 716.39 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
| SMILES | C=CCN(CC1CC(c2ccc(CO)cc2)OC(c2ccc(-c3cccc(CNC(=O)CCCC(=O)Nc4ccccc4N)c3)cc2)O1)C1CCCC1 |
| InChI | InChI=1S/C44H52N4O5/c1-2-25-48(37-11-3-4-12-37)29-38-27-41(34-19-17-31(30-49)18-20-34)53-44(52-38)35-23-21-33(22-24-35)36-10-7-9-32(26-36)28-46-42(50)15-8-16-43(51)47-40-14-6-5-13-39(40)45/h2,5-7,9-10,13-14,17-24,26,37-38,41,44,49H,1,3-4,8,11-12,15-16,25,27-30,45H2,(H,46,50)(H,47,51) |
| InChIKey | FWTTVMSEGJLYJY-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.92 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|