C33H38N2O4 — CID 6707614
N-[4-[(2R,4R,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]benzamide (PubChem CID 6707614) has the molecular formula C33H38N2O4 and a molecular weight of 526.68 g/mol. Its IUPAC name is N-[4-[(2R,4R,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]benzamide.
| Compound Name | N-[4-[(2R,4R,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 6707614 |
| Molecular Formula | C33H38N2O4 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | N-[4-[(2R,4R,6S)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]benzamide |
| SMILES | C=CCN(C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(NC(=O)c3ccccc3)cc2)O1)C1CCCC1 |
| InChI | InChI=1S/C33H38N2O4/c1-2-20-35(29-10-6-7-11-29)22-30-21-31(25-14-12-24(23-36)13-15-25)39-33(38-30)27-16-18-28(19-17-27)34-32(37)26-8-4-3-5-9-26/h2-5,8-9,12-19,29-31,33,36H,1,6-7,10-11,20-23H2,(H,34,37)/t30-,31+,33+/m1/s1 |
| InChIKey | UWBBJCBLKWZDMS-DNNYKULVSA-N |
| XLogP | 6.41 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|