C28H33Cl3N2O4 — CID 4533732
2,2,2-trichloro-N-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 4533732) has the molecular formula C28H33Cl3N2O4 and a molecular weight of 567.94 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 4533732 |
| Molecular Formula | C28H33Cl3N2O4 |
| Molecular Weight | 567.94 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | 2,2,2-trichloro-N-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | C=CCN(CC1CC(c2ccc(CO)cc2)OC(c2ccc(NC(=O)C(Cl)(Cl)Cl)cc2)O1)C1CCCC1 |
| InChI | InChI=1S/C28H33Cl3N2O4/c1-2-15-33(23-5-3-4-6-23)17-24-16-25(20-9-7-19(18-34)8-10-20)37-26(36-24)21-11-13-22(14-12-21)32-27(35)28(29,30)31/h2,7-14,23-26,34H,1,3-6,15-18H2,(H,32,35) |
| InChIKey | UFNRQZUNVHWPQA-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.94 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|