C41H42N2O5 — CID 6694939
2-[[3-[4-[(2S,4S,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6694939) has the molecular formula C41H42N2O5 and a molecular weight of 642.80 g/mol. Its IUPAC name is 2-[[3-[4-[(2S,4S,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[4-[(2S,4S,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6694939 |
| Molecular Formula | C41H42N2O5 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.31 |
| IUPAC Name | 2-[[3-[4-[(2S,4S,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | C=CCN(C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(-c3cccc(CN4C(=O)c5ccccc5C4=O)c3)cc2)O1)C1CCCC1 |
| InChI | InChI=1S/C41H42N2O5/c1-2-22-42(34-10-3-4-11-34)26-35-24-38(31-16-14-28(27-44)15-17-31)48-41(47-35)32-20-18-30(19-21-32)33-9-7-8-29(23-33)25-43-39(45)36-12-5-6-13-37(36)40(43)46/h2,5-9,12-21,23,34-35,38,41,44H,1,3-4,10-11,22,24-27H2/t35-,38+,41+/m0/s1 |
| InChIKey | JUSDXHKIKVIQGH-RHTSQMKOSA-N |
| XLogP | 7.62 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|