C45H49N3O7 — CID 6694940
benzyl N-[1-[[3-[4-[(2S,4S,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6694940) has the molecular formula C45H49N3O7 and a molecular weight of 743.90 g/mol. Its IUPAC name is benzyl N-[1-[[3-[4-[(2S,4S,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[[3-[4-[(2S,4S,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6694940 |
| Molecular Formula | C45H49N3O7 |
| Molecular Weight | 743.90 g/mol |
| Exact Mass | 743.36 |
| IUPAC Name | benzyl N-[1-[[3-[4-[(2S,4S,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | C=CCN(C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(-c3cccc(CN4C(=O)CC(NC(=O)OCc5ccccc5)C4=O)c3)cc2)O1)C1CCCC1 |
| InChI | InChI=1S/C45H49N3O7/c1-2-23-47(38-13-6-7-14-38)28-39-25-41(35-17-15-31(29-49)16-18-35)55-44(54-39)36-21-19-34(20-22-36)37-12-8-11-33(24-37)27-48-42(50)26-40(43(48)51)46-45(52)53-30-32-9-4-3-5-10-32/h2-5,8-12,15-22,24,38-41,44,49H,1,6-7,13-14,23,25-30H2,(H,46,52)/t39-,40?,41+,44+/m0/s1 |
| InChIKey | IXVLKRUYABFAEV-IBJOHIHZSA-N |
| XLogP | 7.38 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.90 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|