C38H43N3O7 — CID 3294764
benzyl N-[1-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 3294764) has the molecular formula C38H43N3O7 and a molecular weight of 653.78 g/mol. Its IUPAC name is benzyl N-[1-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 3294764 |
| Molecular Formula | C38H43N3O7 |
| Molecular Weight | 653.78 g/mol |
| Exact Mass | 653.31 |
| IUPAC Name | benzyl N-[1-[4-[4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | C=CCN(CC1CC(c2ccc(CO)cc2)OC(c2ccc(N3C(=O)CC(NC(=O)OCc4ccccc4)C3=O)cc2)O1)C1CCCC1 |
| InChI | InChI=1S/C38H43N3O7/c1-2-20-40(30-10-6-7-11-30)23-32-21-34(28-14-12-26(24-42)13-15-28)48-37(47-32)29-16-18-31(19-17-29)41-35(43)22-33(36(41)44)39-38(45)46-25-27-8-4-3-5-9-27/h2-5,8-9,12-19,30,32-34,37,42H,1,6-7,10-11,20-25H2,(H,39,45) |
| InChIKey | FZAXKZPJJMDAIQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.78 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|