C37H34N2O9S — CID 6707856
4-[[(2R,4R,6S)-2-[4-[2,5-dioxo-3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6707856) has the molecular formula C37H34N2O9S and a molecular weight of 682.75 g/mol. Its IUPAC name is 4-[[(2R,4R,6S)-2-[4-[2,5-dioxo-3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2R,4R,6S)-2-[4-[2,5-dioxo-3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6707856 |
| Molecular Formula | C37H34N2O9S |
| Molecular Weight | 682.75 g/mol |
| Exact Mass | 682.20 |
| IUPAC Name | 4-[[(2R,4R,6S)-2-[4-[2,5-dioxo-3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | O=C(NC1CC(=O)N(c2ccc([C@H]3O[C@@H](CSc4ccc(C(=O)O)cc4)C[C@@H](c4ccc(CO)cc4)O3)cc2)C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H34N2O9S/c40-20-23-6-8-25(9-7-23)32-18-29(22-49-30-16-12-26(13-17-30)35(43)44)47-36(48-32)27-10-14-28(15-11-27)39-33(41)19-31(34(39)42)38-37(45)46-21-24-4-2-1-3-5-24/h1-17,29,31-32,36,40H,18-22H2,(H,38,45)(H,43,44)/t29-,31?,32+,36+/m1/s1 |
| InChIKey | OJMPYLUPORWANB-ZMYLYKCBSA-N |
| XLogP | 5.77 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.75 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|