C44H40N2O9S — CID 6701666
4-[[(2R,4R,6S)-2-[4-[2-[[2,5-dioxo-3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6701666) has the molecular formula C44H40N2O9S and a molecular weight of 772.88 g/mol. Its IUPAC name is 4-[[(2R,4R,6S)-2-[4-[2-[[2,5-dioxo-3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2R,4R,6S)-2-[4-[2-[[2,5-dioxo-3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6701666 |
| Molecular Formula | C44H40N2O9S |
| Molecular Weight | 772.88 g/mol |
| Exact Mass | 772.25 |
| IUPAC Name | 4-[[(2R,4R,6S)-2-[4-[2-[[2,5-dioxo-3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | O=C(NC1CC(=O)N(Cc2ccccc2-c2ccc([C@H]3O[C@@H](CSc4ccc(C(=O)O)cc4)C[C@@H](c4ccc(CO)cc4)O3)cc2)C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C44H40N2O9S/c47-25-28-10-12-31(13-11-28)39-22-35(27-56-36-20-18-32(19-21-36)42(50)51)54-43(55-39)33-16-14-30(15-17-33)37-9-5-4-8-34(37)24-46-40(48)23-38(41(46)49)45-44(52)53-26-29-6-2-1-3-7-29/h1-21,35,38-39,43,47H,22-27H2,(H,45,52)(H,50,51)/t35-,38?,39+,43+/m1/s1 |
| InChIKey | DZJZSNQEBCMKDG-FJSYYGKNSA-N |
| XLogP | 7.44 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.88 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|