C38H36N2O9S — CID 6696128
4-[[(2S,4S,6R)-2-[4-[[2,5-dioxo-3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6696128) has the molecular formula C38H36N2O9S and a molecular weight of 696.78 g/mol. Its IUPAC name is 4-[[(2S,4S,6R)-2-[4-[[2,5-dioxo-3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2S,4S,6R)-2-[4-[[2,5-dioxo-3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6696128 |
| Molecular Formula | C38H36N2O9S |
| Molecular Weight | 696.78 g/mol |
| Exact Mass | 696.21 |
| IUPAC Name | 4-[[(2S,4S,6R)-2-[4-[[2,5-dioxo-3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | O=C(NC1CC(=O)N(Cc2ccc([C@@H]3O[C@H](CSc4ccc(C(=O)O)cc4)C[C@H](c4ccc(CO)cc4)O3)cc2)C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H36N2O9S/c41-21-25-8-10-27(11-9-25)33-18-30(23-50-31-16-14-28(15-17-31)36(44)45)48-37(49-33)29-12-6-24(7-13-29)20-40-34(42)19-32(35(40)43)39-38(46)47-22-26-4-2-1-3-5-26/h1-17,30,32-33,37,41H,18-23H2,(H,39,46)(H,44,45)/t30-,32?,33+,37+/m0/s1 |
| InChIKey | ALNJNDCARJVRBD-FERSUIBNSA-N |
| XLogP | 5.77 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.78 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|