C38H37N3O8S — CID 6707982
benzyl N-[1-[4-[(2R,4R,6S)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6707982) has the molecular formula C38H37N3O8S and a molecular weight of 695.79 g/mol. Its IUPAC name is benzyl N-[1-[4-[(2R,4R,6S)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[4-[(2R,4R,6S)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6707982 |
| Molecular Formula | C38H37N3O8S |
| Molecular Weight | 695.79 g/mol |
| Exact Mass | 695.23 |
| IUPAC Name | benzyl N-[1-[4-[(2R,4R,6S)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | CC(=O)Nc1ccc(SC[C@H]2C[C@@H](c3ccc(CO)cc3)O[C@@H](c3ccc(N4C(=O)CC(NC(=O)OCc5ccccc5)C4=O)cc3)O2)cc1 |
| InChI | InChI=1S/C38H37N3O8S/c1-24(43)39-29-13-17-32(18-14-29)50-23-31-19-34(27-9-7-25(21-42)8-10-27)49-37(48-31)28-11-15-30(16-12-28)41-35(44)20-33(36(41)45)40-38(46)47-22-26-5-3-2-4-6-26/h2-18,31,33-34,37,42H,19-23H2,1H3,(H,39,43)(H,40,46)/t31-,33?,34+,37+/m1/s1 |
| InChIKey | UBECWEUQTDBICK-LXNVAOLGSA-N |
| XLogP | 6.03 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.79 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|