C39H39N3O8S — CID 6704768
benzyl N-[1-[4-[(2S,4S,5R,6R)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6704768) has the molecular formula C39H39N3O8S and a molecular weight of 709.82 g/mol. Its IUPAC name is benzyl N-[1-[4-[(2S,4S,5R,6R)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[4-[(2S,4S,5R,6R)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6704768 |
| Molecular Formula | C39H39N3O8S |
| Molecular Weight | 709.82 g/mol |
| Exact Mass | 709.25 |
| IUPAC Name | benzyl N-[1-[4-[(2S,4S,5R,6R)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | CC(=O)Nc1ccc(SC[C@H]2O[C@@H](c3ccc(N4C(=O)CC(NC(=O)OCc5ccccc5)C4=O)cc3)OC(c3ccc(CO)cc3)[C@H]2C)cc1 |
| InChI | InChI=1S/C39H39N3O8S/c1-24-34(23-51-32-18-14-30(15-19-32)40-25(2)44)49-38(50-36(24)28-10-8-26(21-43)9-11-28)29-12-16-31(17-13-29)42-35(45)20-33(37(42)46)41-39(47)48-22-27-6-4-3-5-7-27/h3-19,24,33-34,36,38,43H,20-23H2,1-2H3,(H,40,44)(H,41,47)/t24-,33?,34+,36?,38+/m0/s1 |
| InChIKey | FHCNJCXECCATAG-VTJHSUHSSA-N |
| XLogP | 6.28 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.82 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|