C38H38N2O8S — CID 6705626
benzyl N-[1-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6705626) has the molecular formula C38H38N2O8S and a molecular weight of 682.80 g/mol. Its IUPAC name is benzyl N-[1-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6705626 |
| Molecular Formula | C38H38N2O8S |
| Molecular Weight | 682.80 g/mol |
| Exact Mass | 682.23 |
| IUPAC Name | benzyl N-[1-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | COc1ccccc1SC[C@@H]1O[C@H](c2ccc(N3C(=O)CC(NC(=O)OCc4ccccc4)C3=O)cc2)OC(c2ccc(CO)cc2)[C@@H]1C |
| InChI | InChI=1S/C38H38N2O8S/c1-24-32(23-49-33-11-7-6-10-31(33)45-2)47-37(48-35(24)27-14-12-25(21-41)13-15-27)28-16-18-29(19-17-28)40-34(42)20-30(36(40)43)39-38(44)46-22-26-8-4-3-5-9-26/h3-19,24,30,32,35,37,41H,20-23H2,1-2H3,(H,39,44)/t24-,30?,32+,35?,37+/m1/s1 |
| InChIKey | CSDSJGFNYCCIND-GGZBHBFCSA-N |
| XLogP | 6.33 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.80 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|