C39H45N3O7 — CID 6704394
benzyl N-[1-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6704394) has the molecular formula C39H45N3O7 and a molecular weight of 667.80 g/mol. Its IUPAC name is benzyl N-[1-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6704394 |
| Molecular Formula | C39H45N3O7 |
| Molecular Weight | 667.80 g/mol |
| Exact Mass | 667.33 |
| IUPAC Name | benzyl N-[1-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | C=CCN(C[C@H]1O[C@@H](c2ccc(N3C(=O)CC(NC(=O)OCc4ccccc4)C3=O)cc2)OC(c2ccc(CO)cc2)[C@H]1C)C1CCCC1 |
| InChI | InChI=1S/C39H45N3O7/c1-3-21-41(31-11-7-8-12-31)23-34-26(2)36(29-15-13-27(24-43)14-16-29)49-38(48-34)30-17-19-32(20-18-30)42-35(44)22-33(37(42)45)40-39(46)47-25-28-9-5-4-6-10-28/h3-6,9-10,13-20,26,31,33-34,36,38,43H,1,7-8,11-12,21-25H2,2H3,(H,40,46)/t26-,33?,34+,36?,38+/m0/s1 |
| InChIKey | FUERPQAQGFPNIJ-MQEASOPJSA-N |
| XLogP | 5.96 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.80 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|