C35H39N3O7 — CID 6681538
benzyl N-[1-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6681538) has the molecular formula C35H39N3O7 and a molecular weight of 613.71 g/mol. Its IUPAC name is benzyl N-[1-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6681538 |
| Molecular Formula | C35H39N3O7 |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.28 |
| IUPAC Name | benzyl N-[1-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | C=CCN(C)C[C@H]1O[C@@H](c2cccc(N3C(=O)CC(NC(=O)OCc4ccccc4)C3=O)c2)OC(c2ccc(CO)cc2)[C@H]1C |
| InChI | InChI=1S/C35H39N3O7/c1-4-17-37(3)20-30-23(2)32(26-15-13-24(21-39)14-16-26)45-34(44-30)27-11-8-12-28(18-27)38-31(40)19-29(33(38)41)36-35(42)43-22-25-9-6-5-7-10-25/h4-16,18,23,29-30,32,34,39H,1,17,19-22H2,2-3H3,(H,36,42)/t23-,29?,30+,32?,34+/m0/s1 |
| InChIKey | CQTXIGOSOTZDTC-LBZOLQQGSA-N |
| XLogP | 4.65 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|