C35H37F5N2O4 — CID 6683504
N-[[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 6683504) has the molecular formula C35H37F5N2O4 and a molecular weight of 644.68 g/mol. Its IUPAC name is N-[[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 6683504 |
| Molecular Formula | C35H37F5N2O4 |
| Molecular Weight | 644.68 g/mol |
| Exact Mass | 644.27 |
| IUPAC Name | N-[[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | C=CCN(C[C@H]1O[C@@H](c2ccc(CNC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)O[C@@H](c2ccc(CO)cc2)[C@H]1C)C1CCCC1 |
| InChI | InChI=1S/C35H37F5N2O4/c1-3-16-42(25-6-4-5-7-25)18-26-20(2)33(23-12-10-22(19-43)11-13-23)46-35(45-26)24-14-8-21(9-15-24)17-41-34(44)27-28(36)30(38)32(40)31(39)29(27)37/h3,8-15,20,25-26,33,35,43H,1,4-7,16-19H2,2H3,(H,41,44)/t20-,26+,33+,35+/m0/s1 |
| InChIKey | OYHVQNUKZBHZCS-JVWKIWOJSA-N |
| XLogP | 7.03 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.68 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|