C32H42N2O6 — CID 6704392
5-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid (PubChem CID 6704392) has the molecular formula C32H42N2O6 and a molecular weight of 550.70 g/mol. Its IUPAC name is 5-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid.
| Compound Name | 5-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6704392 |
| Molecular Formula | C32H42N2O6 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | 5-[4-[(2S,4S,5R,6R)-4-[[cyclopentyl(prop-2-enyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid |
| SMILES | C=CCN(C[C@H]1O[C@@H](c2ccc(NC(=O)CCCC(=O)O)cc2)OC(c2ccc(CO)cc2)[C@H]1C)C1CCCC1 |
| InChI | InChI=1S/C32H42N2O6/c1-3-19-34(27-7-4-5-8-27)20-28-22(2)31(24-13-11-23(21-35)12-14-24)40-32(39-28)25-15-17-26(18-16-25)33-29(36)9-6-10-30(37)38/h3,11-18,22,27-28,31-32,35H,1,4-10,19-21H2,2H3,(H,33,36)(H,37,38)/t22-,28+,31?,32+/m0/s1 |
| InChIKey | ZMISDUIZIQCQFU-HJSUVWJLSA-N |
| XLogP | 5.59 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|