C35H33N3O8S — CID 6707646
benzyl N-[1-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6707646) has the molecular formula C35H33N3O8S and a molecular weight of 655.73 g/mol. Its IUPAC name is benzyl N-[1-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6707646 |
| Molecular Formula | C35H33N3O8S |
| Molecular Weight | 655.73 g/mol |
| Exact Mass | 655.20 |
| IUPAC Name | benzyl N-[1-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | O=C(NC1CC(=O)N(c2ccc([C@H]3O[C@@H](CSc4cccc[n+]4[O-])C[C@@H](c4ccc(CO)cc4)O3)cc2)C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H33N3O8S/c39-20-23-9-11-25(12-10-23)30-18-28(22-47-32-8-4-5-17-37(32)43)45-34(46-30)26-13-15-27(16-14-26)38-31(40)19-29(33(38)41)36-35(42)44-21-24-6-2-1-3-7-24/h1-17,28-30,34,39H,18-22H2,(H,36,42)/t28-,29?,30+,34+/m1/s1 |
| InChIKey | QAQWXBLCWVYGHW-TZMCWGKWSA-N |
| XLogP | 4.71 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.73 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|