C46H63N3O7 — CID 6708276
benzyl N-[1-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6708276) has the molecular formula C46H63N3O7 and a molecular weight of 770.02 g/mol. Its IUPAC name is benzyl N-[1-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6708276 |
| Molecular Formula | C46H63N3O7 |
| Molecular Weight | 770.02 g/mol |
| Exact Mass | 769.47 |
| IUPAC Name | benzyl N-[1-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(N3C(=O)CC(NC(=O)OCc4ccccc4)C3=O)cc2)O1 |
| InChI | InChI=1S/C46H63N3O7/c1-3-5-7-9-11-16-28-48(29-17-12-10-8-6-4-2)32-40-30-42(37-22-20-35(33-50)21-23-37)56-45(55-40)38-24-26-39(27-25-38)49-43(51)31-41(44(49)52)47-46(53)54-34-36-18-14-13-15-19-36/h13-15,18-27,40-42,45,50H,3-12,16-17,28-34H2,1-2H3,(H,47,53)/t40-,41?,42+,45+/m1/s1 |
| InChIKey | QUVXFSVZXRCKKY-GRAFIVFMSA-N |
| XLogP | 9.31 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.02 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|